EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26O6 |
| Net Charge | 0 |
| Average Mass | 362.422 |
| Monoisotopic Mass | 362.17294 |
| SMILES | [H][C@@]12O[C@]3([H])[C@@]45C(=O)C(=C)[C@@]3([H])CC[C@@]4([H])[C@@]13[C@@H](O)CCC(C)(C)[C@@]3([H])[C@H](O)[C@@]5(O)O2 |
| InChI | InChI=1S/C20H26O6/c1-8-9-4-5-10-18-11(21)6-7-17(2,3)12(18)14(23)20(24)19(10,13(8)22)15(9)25-16(18)26-20/h9-12,14-16,21,23-24H,1,4-7H2,2-3H3/t9-,10+,11+,12-,14+,15+,16+,18+,19+,20-/m1/s1 |
| InChIKey | WHRDRHNMTIXZNY-OSMZMOMSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Isodon adenolomus (ncbitaxon:662903) | aerial part (BTO:0001658) | PubMed (21534539) | 70% aqueous acetone extract of air-dried and powdered aerial parts |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ponicidin (CHEBI:67671) has role metabolite (CHEBI:25212) |
| Ponicidin (CHEBI:67671) is a dioxanes (CHEBI:46926) |
| Synonyms | Source |
|---|---|
| (1-alpha,6-beta,7-alpha,14S,20S)-7,20:14,20-Diepoxy-1,6,7-trihydroxy-ent-kaur-16-en-15-one | ChEBI |
| Rubescensin B | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:52617-37-5 | ChemIDplus |
| Citations |
|---|