EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26O6 |
| Net Charge | 0 |
| Average Mass | 362.422 |
| Monoisotopic Mass | 362.17294 |
| SMILES | [H][C@@]12O[C@]3([H])[C@@]45C(=O)C(=C)[C@@]3([H])C[C@H](O)[C@@]4([H])[C@@]13CCCC(C)(C)[C@@]3([H])[C@H](O)[C@@]5(O)O2 |
| InChI | InChI=1S/C20H26O6/c1-8-9-7-10(21)11-18-6-4-5-17(2,3)12(18)14(23)20(24)19(11,13(8)22)15(9)25-16(18)26-20/h9-12,14-16,21,23-24H,1,4-7H2,2-3H3/t9-,10+,11+,12-,14+,15+,16+,18-,19+,20-/m1/s1 |
| InChIKey | GSRZMSWBSLHHAD-NBPWNTTESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Isodon adenolomus (ncbitaxon:662903) | aerial part (BTO:0001658) | PubMed (21534539) | 70% aqueous acetone extract of air-dried and powdered aerial parts |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Macrocalin B (CHEBI:67670) has role metabolite (CHEBI:25212) |
| Macrocalin B (CHEBI:67670) is a dioxanes (CHEBI:46926) |
| Synonym | Source |
|---|---|
| ent-Kaur-16-en-15-one, 7,20:14,20-diepoxy-6,7,11-trihydroxy-,(6beta,7alpha,11beta,14S,20S)- | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:93781-75-0 | ChemIDplus |
| Citations |
|---|