EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H30O8 |
| Net Charge | 0 |
| Average Mass | 422.474 |
| Monoisotopic Mass | 422.19407 |
| SMILES | [H][C@@]12CC[C@]3([H])C(=C)C(=O)[C@@]1([C@@H]3O)[C@]1(O)OC(O)[C@]23[C@@H](OC(C)=O)CCC(C)(C)[C@@]3([H])[C@@H]1O |
| InChI | InChI=1S/C22H30O8/c1-9-11-5-6-12-20-13(29-10(2)23)7-8-19(3,4)14(20)17(26)22(28,30-18(20)27)21(12,15(9)24)16(11)25/h11-14,16-18,25-28H,1,5-8H2,2-4H3/t11-,12+,13+,14-,16-,17+,18?,20+,21+,22-/m1/s1 |
| InChIKey | WASCTSNYBVCLTC-GOHJPJHGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Isodon adenolomus (ncbitaxon:662903) | aerial part (BTO:0001658) | PubMed (21534539) | 70% aqueous acetone extract of air-dried and powdered aerial parts |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Xerophilusin J (CHEBI:67668) has role metabolite (CHEBI:25212) |
| Xerophilusin J (CHEBI:67668) is a kaurane diterpenoid (CHEBI:53666) |
| Citations |
|---|