EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H30O6 |
| Net Charge | 0 |
| Average Mass | 390.476 |
| Monoisotopic Mass | 390.20424 |
| SMILES | [H][C@]12C[C@@H](OC(C)=O)[C@@]3([H])[C@]45CCCC(C)(C)[C@@]4([H])[C@H](O)[C@@](O)(OC5)[C@]3(C1)C(=O)C2=C |
| InChI | InChI=1S/C22H30O6/c1-11-13-8-14(28-12(2)23)15-20-7-5-6-19(3,4)16(20)18(25)22(26,27-10-20)21(15,9-13)17(11)24/h13-16,18,25-26H,1,5-10H2,2-4H3/t13-,14+,15-,16+,18-,20+,21-,22+/m0/s1 |
| InChIKey | VLCMAXYGZMNIMT-HZOQYMFKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Isodon adenolomus (ncbitaxon:662903) | aerial part (BTO:0001658) | PubMed (21534539) | 70% aqueous acetone extract of air-dried and powdered aerial parts |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Longikaurin E (CHEBI:67667) has role metabolite (CHEBI:25212) |
| Longikaurin E (CHEBI:67667) is a kaurane diterpenoid (CHEBI:53666) |
| Citations |
|---|