EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H30O7 |
| Net Charge | 0 |
| Average Mass | 406.475 |
| Monoisotopic Mass | 406.19915 |
| SMILES | [H][C@@]12CC[C@]3([H])C(=C)C(=O)[C@@]1([C@@H]3O)[C@]1(O)OC[C@]23[C@@H](OC(C)=O)CCC(C)(C)[C@@]3([H])[C@@H]1O |
| InChI | InChI=1S/C22H30O7/c1-10-12-5-6-13-20-9-28-22(27,21(13,16(10)24)17(12)25)18(26)15(20)19(3,4)8-7-14(20)29-11(2)23/h12-15,17-18,25-27H,1,5-9H2,2-4H3/t12-,13+,14+,15-,17-,18+,20-,21+,22-/m1/s1 |
| InChIKey | DJQLJZNVICMJRV-XMJLGDTCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Isodon adenolomus (ncbitaxon:662903) | aerial part (BTO:0001658) | PubMed (21534539) | 70% aqueous acetone extract of air-dried and powdered aerial parts |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Lasiokaurin (CHEBI:67664) has role metabolite (CHEBI:25212) |
| Lasiokaurin (CHEBI:67664) is a kaurane diterpenoid (CHEBI:53666) |
| Synonym | Source |
|---|---|
| ent-Kaur-16-en-15-one, 1-(acetyloxy)-7,20-epoxy-6,7,14-trihydroxy-, (1alpha,6beta,7alpha,14R)- | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:28957-08-6 | ChemIDplus |
| Citations |
|---|