EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H30O7 |
| Net Charge | 0 |
| Average Mass | 406.475 |
| Monoisotopic Mass | 406.19915 |
| SMILES | [H][C@@]12C[C@]3(C(=C[C@@H]1O)[C@@]14CO[C@@]3(O)[C@@H](O)[C@]1([H])C(C)(C)CC[C@@H]4OC(C)=O)[C@H](O)C2=C |
| InChI | InChI=1S/C22H30O7/c1-10-12-8-21(17(10)25)14(7-13(12)24)20-9-28-22(21,27)18(26)16(20)19(3,4)6-5-15(20)29-11(2)23/h7,12-13,15-18,24-27H,1,5-6,8-9H2,2-4H3/t12-,13-,15-,16+,17+,18-,20+,21-,22-/m0/s1 |
| InChIKey | FVWUMQGTOQVUIL-NOILNLMISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Isodon adenolomus (ncbitaxon:662903) | aerial part (BTO:0001658) | PubMed (21534539) | 70% aqueous acetone extract of air-dried and powdered aerial parts |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Isoadenolin K (CHEBI:67662) has role metabolite (CHEBI:25212) |
| Isoadenolin K (CHEBI:67662) is a kaurane diterpenoid (CHEBI:53666) |
| Synonym | Source |
|---|---|
| 1alpha-acetoxy-6beta,7beta,12alpha,15beta-tetrahydroxy-7alpha,20-epoxy-entkaur-9(11),16-diene | ChEBI |
| Citations |
|---|