EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H28O6 |
| Net Charge | 0 |
| Average Mass | 388.460 |
| Monoisotopic Mass | 388.18859 |
| SMILES | [H][C@]12CC=C3[C@@](C1)(C(=O)C2=C)[C@@]1(O)OC[C@]32[C@@H](OC(C)=O)CCC(C)(C)[C@@]2([H])[C@@H]1O |
| InChI | InChI=1S/C22H28O6/c1-11-13-5-6-14-20-10-27-22(26,21(14,9-13)17(11)24)18(25)16(20)19(3,4)8-7-15(20)28-12(2)23/h6,13,15-16,18,25-26H,1,5,7-10H2,2-4H3/t13-,15-,16+,18-,20+,21-,22-/m0/s1 |
| InChIKey | YANOCUIQFVTZFB-KTAPYFENSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Isodon adenolomus (ncbitaxon:662903) | aerial part (BTO:0001658) | PubMed (21534539) | 70% aqueous acetone extract of air-dried and powdered aerial parts |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Isoadenolin I, (rel)- (CHEBI:67660) has role metabolite (CHEBI:25212) |
| Isoadenolin I, (rel)- (CHEBI:67660) is a kaurane diterpenoid (CHEBI:53666) |
| Synonym | Source |
|---|---|
| rel-1alpha-acetoxy-6beta,7beta-dihydroxy-7alpha,20-epoxy-ent-kaur-9(11),16-dien-15-one | ChEBI |
| Citations |
|---|