EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H32O7 |
| Net Charge | 0 |
| Average Mass | 396.480 |
| Monoisotopic Mass | 396.21480 |
| SMILES | [H][C@@]12[C@@H](O)C[C@]3([H])C(=C)[C@@H](O)[C@@]1([C@@H]3O)[C@@]1(O)O[C@H](OC)[C@]23CCCC(C)(C)[C@@]3([H])[C@@H]1O |
| InChI | InChI=1S/C21H32O7/c1-9-10-8-11(22)12-19-7-5-6-18(2,3)13(19)16(25)21(26,28-17(19)27-4)20(12,14(9)23)15(10)24/h10-17,22-26H,1,5-8H2,2-4H3/t10-,11+,12+,13-,14-,15-,16+,17+,19-,20+,21+/m1/s1 |
| InChIKey | MQFOWMSWYZXMPL-JXMVGPHCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Isodon adenolomus (ncbitaxon:662903) | aerial part (BTO:0001658) | PubMed (21534539) | 70% aqueous acetone extract of air-dried and powdered aerial parts |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Isoadenolin E, (rel)- (CHEBI:67656) has role metabolite (CHEBI:25212) |
| Isoadenolin E, (rel)- (CHEBI:67656) is a kaurane diterpenoid (CHEBI:53666) |
| Synonym | Source |
|---|---|
| rel-20(S)-6beta,7beta,11beta,14beta,15beta-pentahydroxy-20-methoxy-7alpha,20-epoxy-ent-kaur-16-ene | ChEBI |
| Citations |
|---|