EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H34O8 |
| Net Charge | 0 |
| Average Mass | 426.506 |
| Monoisotopic Mass | 426.22537 |
| SMILES | [H][C@@]12C[C@H](O)[C@@]3([H])[C@]45CCCC(C)(C)[C@@]4([H])[C@H](O)[C@](O)(O[C@@H]5OC)[C@@]3(C(=O)[C@H]1COC)[C@@H]2O |
| InChI | InChI=1S/C22H34O8/c1-19(2)6-5-7-20-13-12(23)8-10-11(9-28-3)16(25)21(13,15(10)24)22(27,17(26)14(19)20)30-18(20)29-4/h10-15,17-18,23-24,26-27H,5-9H2,1-4H3/t10-,11+,12+,13+,14-,15-,17+,18+,20-,21-,22+/m1/s1 |
| InChIKey | PJMGRTQORMIETN-ANWIMLHSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Isodon adenolomus (ncbitaxon:662903) | aerial part (BTO:0001658) | PubMed (21534539) | 70% aqueous acetone extract of air-dried and powdered aerial parts |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Isoadenolin D, (rel)- (CHEBI:67655) has role metabolite (CHEBI:25212) |
| Isoadenolin D, (rel)- (CHEBI:67655) is a kaurane diterpenoid (CHEBI:53666) |
| Synonym | Source |
|---|---|
| rel-16(R),20(S)-6beta,7beta,11beta,14beta-tetrahydroxy-17,20-dimethoxy-7alpha,20-epoxy-ent-kaur-15-one | ChEBI |
| Citations |
|---|