EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H26O7 |
| Net Charge | 0 |
| Average Mass | 390.432 |
| Monoisotopic Mass | 390.16785 |
| SMILES | COc1cc2c(cc1O)[C@@H](c1cc(OC)c(O)c(OC)c1)[C@H](CO)[C@@H](CO)C2 |
| InChI | InChI=1S/C21H26O7/c1-26-17-5-11-4-13(9-22)15(10-23)20(14(11)8-16(17)24)12-6-18(27-2)21(25)19(7-12)28-3/h5-8,13,15,20,22-25H,4,9-10H2,1-3H3/t13-,15-,20-/m1/s1 |
| InChIKey | JUJIQKRWLCSYQD-WAWZGNHOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sinocalamus affinis (IPNI:421970-1) | stem (BTO:0001300) | PubMed (21469695) | 95% Ethanolic extract of skin-removed, air-dried, powdered stems. |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-5'-methoxyisolariciresinol (CHEBI:67648) has role plant metabolite (CHEBI:76924) |
| (−)-5'-methoxyisolariciresinol (CHEBI:67648) is a dimethoxybenzene (CHEBI:51681) |
| (−)-5'-methoxyisolariciresinol (CHEBI:67648) is a lignan (CHEBI:25036) |
| (−)-5'-methoxyisolariciresinol (CHEBI:67648) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| (6S,7S,8R)-8-(4-hydroxy-3,5-dimethoxyphenyl)-6,7-bis(hydroxymethyl)-3-methoxy-5,6,7,8-tetrahydronaphthalen-2-ol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7357972 | Reaxys |
| Citations |
|---|