EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H16O7 |
| Net Charge | 0 |
| Average Mass | 344.319 |
| Monoisotopic Mass | 344.08960 |
| SMILES | COc1cc(O)c2c(=O)cc(-c3cc(OC)c(O)c(OC)c3)oc2c1 |
| InChI | InChI=1S/C18H16O7/c1-22-10-6-11(19)17-12(20)8-13(25-14(17)7-10)9-4-15(23-2)18(21)16(5-9)24-3/h4-8,19,21H,1-3H3 |
| InChIKey | VIKKUMIXGIDYKY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sinocalamus affinis (IPNI:421970-1) | stem (BTO:0001300) | PubMed (21469695) | 95% Ethanolic extract of skin-removed, air-dried, powdered stems. |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-methoxytricin (CHEBI:67647) has functional parent 3',5'-di-O-methyltricetin (CHEBI:59979) |
| 7-methoxytricin (CHEBI:67647) has role plant metabolite (CHEBI:76924) |
| 7-methoxytricin (CHEBI:67647) is a dihydroxyflavone (CHEBI:38686) |
| 7-methoxytricin (CHEBI:67647) is a trimethoxyflavone (CHEBI:27124) |
| IUPAC Name |
|---|
| 5-hydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-7-methoxy-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 5,4'-dihydroxy-7,3',5'-trimethoxyflavone | ChEBI |
| 7,3',5'-tri-O-methyltricetin | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5623920 | Reaxys |
| Citations |
|---|