EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H24O7 |
| Net Charge | 0 |
| Average Mass | 388.416 |
| Monoisotopic Mass | 388.15220 |
| SMILES | [H][C@]12CO[C@H](c3cc(OC)c(O)c(OC)c3)[C@@]1([H])CO[C@@H]2c1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C21H24O7/c1-24-16-6-11(4-5-15(16)22)20-13-9-28-21(14(13)10-27-20)12-7-17(25-2)19(23)18(8-12)26-3/h4-8,13-14,20-23H,9-10H2,1-3H3/t13-,14-,20+,21+/m0/s1 |
| InChIKey | VJOBNGRIBLNUKN-BMHXQBNDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sinocalamus affinis (IPNI:421970-1) | stem (BTO:0001300) | PubMed (21469695) | 95% Ethanolic extract of skin-removed, air-dried, powdered stems. |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-medioresinol (CHEBI:67644) has role plant metabolite (CHEBI:76924) |
| (−)-medioresinol (CHEBI:67644) is a dimethoxybenzene (CHEBI:51681) |
| (−)-medioresinol (CHEBI:67644) is a furofuran (CHEBI:47790) |
| (−)-medioresinol (CHEBI:67644) is a lignan (CHEBI:25036) |
| (−)-medioresinol (CHEBI:67644) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| 4-[(1S,3aR,4S,6aR)-4-(4-hydroxy-3-methoxyphenyl)tetrahydro-1H,3H-furo[3,4-c]furan-1-yl]-2,6-dimethoxyphenol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4569869 | Reaxys |
| Citations |
|---|