EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H28O8 |
| Net Charge | 0 |
| Average Mass | 432.469 |
| Monoisotopic Mass | 432.17842 |
| SMILES | [H][C@@]12CO[C@@H](c3cc(OC)c(OC)c(OC)c3)[C@]1([H])CO[C@H]2c1cc(OC)c(O)c(OC)c1 |
| InChI | InChI=1S/C23H28O8/c1-25-16-6-12(7-17(26-2)20(16)24)21-14-10-31-22(15(14)11-30-21)13-8-18(27-3)23(29-5)19(9-13)28-4/h6-9,14-15,21-22,24H,10-11H2,1-5H3/t14-,15-,21+,22+/m1/s1 |
| InChIKey | AJMQKDTUOKAQNT-SDVFQCAASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sinocalamus affinis (IPNI:421970-1) | stem (BTO:0001300) | PubMed (21469695) | 95% Ethanolic extract of skin-removed, air-dried, powdered stems. |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-(7R,7'R,8S,8'S)-4'-hydroxy-3,3',4,5,5'-pentamethoxy-7,9':7',9-diepoxylignane (CHEBI:67630) has role plant metabolite (CHEBI:76924) |
| (−)-(7R,7'R,8S,8'S)-4'-hydroxy-3,3',4,5,5'-pentamethoxy-7,9':7',9-diepoxylignane (CHEBI:67630) is a furofuran (CHEBI:47790) |
| (−)-(7R,7'R,8S,8'S)-4'-hydroxy-3,3',4,5,5'-pentamethoxy-7,9':7',9-diepoxylignane (CHEBI:67630) is a lignan (CHEBI:25036) |
| (−)-(7R,7'R,8S,8'S)-4'-hydroxy-3,3',4,5,5'-pentamethoxy-7,9':7',9-diepoxylignane (CHEBI:67630) is a methoxybenzenes (CHEBI:51683) |
| (−)-(7R,7'R,8S,8'S)-4'-hydroxy-3,3',4,5,5'-pentamethoxy-7,9':7',9-diepoxylignane (CHEBI:67630) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 2,6-dimethoxy-4-[(1R,3aS,4R,6aS)-4-(3,4,5-trimethoxyphenyl)tetrahydro-1H,3H-furo[3,4-c]furan-1-yl]phenol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21559774 | Reaxys |
| Citations |
|---|