EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H8Br2HgO6.2Na |
| Net Charge | 0 |
| Average Mass | 750.656 |
| Monoisotopic Mass | 749.81894 |
| SMILES | O=C([O-])c1ccccc1-c1c2cc(Br)c(=O)cc-2oc2[c]([Hg][OH])c([O-])c(Br)cc12.[Na+].[Na+] |
| InChI | InChI=1S/C20H9Br2O5.Hg.2Na.H2O/c21-13-5-11-17(7-15(13)23)27-18-8-16(24)14(22)6-12(18)19(11)9-3-1-2-4-10(9)20(25)26;;;;/h1-7,24H,(H,25,26);;;;1H2/q;3*+1;/p-3 |
| InChIKey | SQFDQLBYJKFDDO-UHFFFAOYSA-K |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | fluorochrome A fluorescent dye used to stain biological specimens. antiseptic drug A substance used locally on humans and other animals to destroy harmful microorganisms or to inhibit their activity (cf. disinfectants, which destroy microorganisms found on non-living objects, and antibiotics, which can be transported through the lymphatic system to destroy bacteria within the body). histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| merbromin (CHEBI:6763) has part 2,7-dibromo-4-hydroxymercurifluorescein(2−) (CHEBI:90220) |
| merbromin (CHEBI:6763) has role antiseptic drug (CHEBI:48218) |
| merbromin (CHEBI:6763) has role fluorochrome (CHEBI:51217) |
| merbromin (CHEBI:6763) has role histological dye (CHEBI:77178) |
| merbromin (CHEBI:6763) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| disodium [2,7-dibromo-9-(2-carboxylatophenyl)-6-oxido-3-oxo-3H-xanthen-5-yl](hydroxy)mercury |
| INNs | Source |
|---|---|
| merbromina | ChemIDplus |
| merbromine | ChemIDplus |
| merbrominum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2,7-Dibromo-4-hydroxymercurifluoresceine disodium salt | ChemIDplus |
| Disodium 2',7'-dibromo-4'-(hydroxymercury)fluorescein | ChemIDplus |
| Mercurochrome | KEGG DRUG |
| Citations |
|---|