EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H26O6 |
| Net Charge | 0 |
| Average Mass | 386.444 |
| Monoisotopic Mass | 386.17294 |
| SMILES | CCOC/C=C/c1cc(OC)c2c(c1)[C@H](CO)[C@@H](c1ccc(O)c(OC)c1)O2 |
| InChI | InChI=1S/C22H26O6/c1-4-27-9-5-6-14-10-16-17(13-23)21(28-22(16)20(11-14)26-3)15-7-8-18(24)19(12-15)25-2/h5-8,10-12,17,21,23-24H,4,9,13H2,1-3H3/b6-5+/t17-,21+/m0/s1 |
| InChIKey | BZEQILYKRZZMGE-DFUKUNQBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sinocalamus affinis (IPNI:421970-1) | stem (BTO:0001300) | PubMed (21469695) | 95% Ethanolic extract of skin-removed, air-dried, powdered stems. |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-(7S,8R,7'E)-4-hydroxy-3,5'-dimethoxy-4',7-epoxy-8,3'-neolign-7'-ene-9,9'-diol-9'-ethyl ether (CHEBI:67627) has role plant metabolite (CHEBI:76924) |
| (+)-(7S,8R,7'E)-4-hydroxy-3,5'-dimethoxy-4',7-epoxy-8,3'-neolign-7'-ene-9,9'-diol-9'-ethyl ether (CHEBI:67627) is a benzofurans (CHEBI:35259) |
| (+)-(7S,8R,7'E)-4-hydroxy-3,5'-dimethoxy-4',7-epoxy-8,3'-neolign-7'-ene-9,9'-diol-9'-ethyl ether (CHEBI:67627) is a guaiacols (CHEBI:134251) |
| (+)-(7S,8R,7'E)-4-hydroxy-3,5'-dimethoxy-4',7-epoxy-8,3'-neolign-7'-ene-9,9'-diol-9'-ethyl ether (CHEBI:67627) is a neolignan (CHEBI:25497) |
| IUPAC Name |
|---|
| 4-[(2S,3R)-5-[(1E)-3-ethoxyprop-1-en-1-yl]-3-(hydroxymethyl)-7-methoxy-2,3-dihydro-1-benzofuran-2-yl]-2-methoxyphenol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21559769 | Reaxys |
| Citations |
|---|