EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H22O8 |
| Net Charge | 0 |
| Average Mass | 366.366 |
| Monoisotopic Mass | 366.13147 |
| SMILES | COc1cc([C@H](O)[C@H](CO)Oc2c(OC)cc(O)cc2OC)ccc1O |
| InChI | InChI=1S/C18H22O8/c1-23-13-6-10(4-5-12(13)21)17(22)16(9-19)26-18-14(24-2)7-11(20)8-15(18)25-3/h4-8,16-17,19-22H,9H2,1-3H3/t16-,17-/m0/s1 |
| InChIKey | LFLJRVPKZONUDD-IRXDYDNUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sinocalamus affinis (IPNI:421970-1) | stem (BTO:0001300) | PubMed (21469695) | 95% Ethanolic extract of skin-removed, air-dried, powdered stems. |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-(7S,8S)-1',4-dihydroxy-3,3',5'-trimethoxy-7',8',9'-trinor-8,4'-oxyneolignan-7,9-diol (CHEBI:67623) has role plant metabolite (CHEBI:76924) |
| (+)-(7S,8S)-1',4-dihydroxy-3,3',5'-trimethoxy-7',8',9'-trinor-8,4'-oxyneolignan-7,9-diol (CHEBI:67623) is a dimethoxybenzene (CHEBI:51681) |
| (+)-(7S,8S)-1',4-dihydroxy-3,3',5'-trimethoxy-7',8',9'-trinor-8,4'-oxyneolignan-7,9-diol (CHEBI:67623) is a lignan (CHEBI:25036) |
| (+)-(7S,8S)-1',4-dihydroxy-3,3',5'-trimethoxy-7',8',9'-trinor-8,4'-oxyneolignan-7,9-diol (CHEBI:67623) is a phenols (CHEBI:33853) |
| (+)-(7S,8S)-1',4-dihydroxy-3,3',5'-trimethoxy-7',8',9'-trinor-8,4'-oxyneolignan-7,9-diol (CHEBI:67623) is a primary alcohol (CHEBI:15734) |
| (+)-(7S,8S)-1',4-dihydroxy-3,3',5'-trimethoxy-7',8',9'-trinor-8,4'-oxyneolignan-7,9-diol (CHEBI:67623) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (1S,2S)-2-(4-hydroxy-2,6-dimethoxyphenoxy)-1-(4-hydroxy-3-methoxyphenyl)propane-1,3-diol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21559768 | Reaxys |
| Citations |
|---|