EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H26O8 |
| Net Charge | 0 |
| Average Mass | 418.442 |
| Monoisotopic Mass | 418.16277 |
| SMILES | [H][C@]12COc3cc(OC)c(O)c(OC)c3[C@]([H])(c3c(cc(OC)c(O)c3OC)C1)[C@]2([H])CO |
| InChI | InChI=1S/C22H26O8/c1-26-14-6-10-5-11-9-30-13-7-15(27-2)20(25)22(29-4)18(13)17(12(11)8-23)16(10)21(28-3)19(14)24/h6-7,11-12,17,23-25H,5,8-9H2,1-4H3/t11-,12-,17+/m1/s1 |
| InChIKey | VCZWWJGHKZTTAS-QFSBIZTOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sinocalamus affinis (IPNI:421970-1) | stem (BTO:0001300) | PubMed (21469695) | 95% Ethanolic extract of skin-removed, air-dried, powdered stems. |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-(7'S,8S,8'S)-3',4-dihydroxy-2',3,4',5-tetramethoxy-6',9-epoxy-2,7'-cyclolignan-9'-ol (CHEBI:67622) has role plant metabolite (CHEBI:76924) |
| (+)-(7'S,8S,8'S)-3',4-dihydroxy-2',3,4',5-tetramethoxy-6',9-epoxy-2,7'-cyclolignan-9'-ol (CHEBI:67622) is a aromatic ether (CHEBI:35618) |
| (+)-(7'S,8S,8'S)-3',4-dihydroxy-2',3,4',5-tetramethoxy-6',9-epoxy-2,7'-cyclolignan-9'-ol (CHEBI:67622) is a lignan (CHEBI:25036) |
| (+)-(7'S,8S,8'S)-3',4-dihydroxy-2',3,4',5-tetramethoxy-6',9-epoxy-2,7'-cyclolignan-9'-ol (CHEBI:67622) is a polyphenol (CHEBI:26195) |
| (+)-(7'S,8S,8'S)-3',4-dihydroxy-2',3,4',5-tetramethoxy-6',9-epoxy-2,7'-cyclolignan-9'-ol (CHEBI:67622) is a primary alcohol (CHEBI:15734) |
| IUPAC Name |
|---|
| (7S,13S,14S)-14-(hydroxymethyl)-1,3,10,12-tetramethoxy-6,7,8,13-tetrahydro-7,13-methanodibenzo[b,e]oxonine-2,11-diol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21559776 | Reaxys |
| Citations |
|---|