EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H23N3O |
| Net Charge | 0 |
| Average Mass | 285.391 |
| Monoisotopic Mass | 285.18411 |
| SMILES | COc1ccc(CN(CCN(C)C)c2ccccn2)cc1 |
| InChI | InChI=1S/C17H23N3O/c1-19(2)12-13-20(17-6-4-5-11-18-17)14-15-7-9-16(21-3)10-8-15/h4-11H,12-14H2,1-3H3 |
| InChIKey | YECBIJXISLIIDS-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| Application: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mepyramine (CHEBI:6762) has role H1-receptor antagonist (CHEBI:37955) |
| mepyramine (CHEBI:6762) is a aromatic ether (CHEBI:35618) |
| mepyramine (CHEBI:6762) is a ethylenediamine derivative (CHEBI:31577) |
| IUPAC Name |
|---|
| N-(4-methoxybenzyl)-N',N'-dimethyl-N-pyridin-2-ylethane-1,2-diamine |
| Synonyms | Source |
|---|---|
| N-[(4-methoxyphenyl)methyl]-N',N'-dimethyl-N-2-pyridinyl-1,2-ethanediamine | NIST Chemistry WebBook |
| N',N'-dimethyl-N-(p-methoxybenzyl)-N-(2-pyridyl)ethylenediamine | NIST Chemistry WebBook |
| N-(p-methoxybenzyl)-N',N'-dimethyl-N-(α-pyridyl)ethylenediamine | NIST Chemistry WebBook |
| Mepyramine | KEGG COMPOUND |
| pyranisamine | ChemIDplus |
| Pyrilamine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 2331 | DrugCentral |
| C11798 | KEGG COMPOUND |
| D08183 | KEGG DRUG |
| DB06691 | DrugBank |
| HMDB0015639 | HMDB |
| LSM-4206 | LINCS |
| Pyrilamine | Wikipedia |
| Citations |
|---|