EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H27ClO6 |
| Net Charge | 0 |
| Average Mass | 434.916 |
| Monoisotopic Mass | 434.14962 |
| SMILES | [H][C@]12C3=COC(/C=C/C(C)CC)=CC3=C(Cl)C(=O)[C@@]1(C)O[C@]1(O)[C@H](C)[C@@H](C)OC(=O)[C@]21[H] |
| InChI | InChI=1S/C23H27ClO6/c1-6-11(2)7-8-14-9-15-16(10-28-14)17-18-21(26)29-13(4)12(3)23(18,27)30-22(17,5)20(25)19(15)24/h7-13,17-18,27H,6H2,1-5H3/b8-7+/t11?,12-,13-,17-,18+,22+,23-/m1/s1 |
| InChIKey | VFAOIGZBHFMFIU-WGJHMWEWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chaetomium globosum (ncbitaxon:38033) | |||
| mycelium (BTO:0001436) | PubMed (21548578) | Endophytic fungus in leaves of Viguiera robusta, EtOAc extract of culture broth and mycelium | |
| - | PubMed (21854043) |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. Chaetomium metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Chaetomium. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chaetoviridin B (CHEBI:67611) has role Chaetomium metabolite (CHEBI:76960) |
| chaetoviridin B (CHEBI:67611) has role antifungal agent (CHEBI:35718) |
| chaetoviridin B (CHEBI:67611) is a enone (CHEBI:51689) |
| chaetoviridin B (CHEBI:67611) is a lactol (CHEBI:38131) |
| chaetoviridin B (CHEBI:67611) is a organic heterotetracyclic compound (CHEBI:38163) |
| chaetoviridin B (CHEBI:67611) is a organochlorine compound (CHEBI:36683) |
| chaetoviridin B (CHEBI:67611) is a δ-lactone (CHEBI:18946) |
| IUPAC Name |
|---|
| (6aS,7aR,8R,9R,11aR,11bS)-5-chloro-7a-hydroxy-6a,8,9-trimethyl-3-[(1E)-3-methylpent-1-en-1-yl]-6a,7a,8,9,11a,11b-hexahydro-6H,11H-pyrano[3',4':4,5]furo[2,3-h][2]benzopyran-6,11-dione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19210016 | Reaxys |
| CAS:128230-03-5 | ChemIDplus |
| Citations |
|---|