EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H18N2O4 |
| Net Charge | 0 |
| Average Mass | 218.253 |
| Monoisotopic Mass | 218.12666 |
| SMILES | CCCC(C)(COC(N)=O)COC(N)=O |
| InChI | InChI=1S/C9H18N2O4/c1-3-4-9(2,5-14-7(10)12)6-15-8(11)13/h3-6H2,1-2H3,(H2,10,12)(H2,11,13) |
| InChIKey | NPPQSCRMBWNHMW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Meprobamate (CHEBI:6761) has role anxiolytic drug (CHEBI:35474) |
| Meprobamate (CHEBI:6761) is a organic molecular entity (CHEBI:50860) |
| INN | Source |
|---|---|
| meprobamato | WHO MedNet |
| Synonyms | Source |
|---|---|
| Equanil (TN) | KEGG COMPOUND |
| meprobam | DrugCentral |
| meprobamat | DrugCentral |
| Meprobamate | KEGG COMPOUND |
| Meprobamate civ | ChEMBL |
| meproban | DrugCentral |
| Brand Names | Source |
|---|---|
| Amosene | ChEMBL |
| Bamate | ChEMBL |
| Equanil | ChEMBL |
| Mepriam | ChEMBL |
| Meprobamate component of equagesic | ChEMBL |
| Meprobamate component of mepro-aspirin | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1704 | DrugCentral |
| D00376 | KEGG DRUG |
| HMDB0014515 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:57-53-4 | KEGG COMPOUND |
| Citations |
|---|