EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H28O3 |
| Net Charge | 0 |
| Average Mass | 256.386 |
| Monoisotopic Mass | 256.20384 |
| SMILES | CCCCCCC[C@@H](C/C=C/CCC(=O)O)OC |
| InChI | InChI=1S/C15H28O3/c1-3-4-5-6-8-11-14(18-2)12-9-7-10-13-15(16)17/h7,9,14H,3-6,8,10-13H2,1-2H3,(H,16,17)/b9-7+/t14-/m0/s1 |
| InChIKey | DHIPOEWPWSLXNL-KGXGESDWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hormoscilla (ncbitaxon:881023) | - | PubMed (21473610) | CH2Cl2/MeOH(2:1) extract of assemblage of two cyanobacteria, Oscillatoria sp. and Hormoscilla sp. |
| Lyngbya (ncbitaxon:28073) | - | PubMed (21155594) | Dichloromethane/Methanol (2:1) extract |
| Oscillatoria sp. (ncbitaxon:1159) | - | PubMed (21473610) | CH2Cl2/MeOH(2:1) extract of assemblage of two cyanobacteria, Oscillatoria sp. and Hormoscilla sp. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Lyngbic acid (CHEBI:67609) has role metabolite (CHEBI:25212) |
| Lyngbic acid (CHEBI:67609) is a long-chain fatty acid (CHEBI:15904) |
| Synonyms | Source |
|---|---|
| 7S-methoxytetradec-4(E)-enoic acid | ChEBI |
| (E,7S)-7-methoxytetradec-4-enoic acid | ChEBI |
| Citations |
|---|