EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H10O3S |
| Net Charge | 0 |
| Average Mass | 174.221 |
| Monoisotopic Mass | 174.03507 |
| SMILES | COC1=CC(=O)S[C@@H](CO)C1 |
| InChI | InChI=1S/C7H10O3S/c1-10-5-2-6(4-8)11-7(9)3-5/h3,6,8H,2,4H2,1H3/t6-/m1/s1 |
| InChIKey | LDZGBXIHQQUFKM-ZCFIWIBFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hormoscilla (ncbitaxon:881023) | - | PubMed (21473610) | CH2Cl2/MeOH(2:1) extract of assemblage of two cyanobacteria, Oscillatoria sp. and Hormoscilla sp. |
| Oscillatoria sp. (ncbitaxon:1159) | - | PubMed (21473610) | CH2Cl2/MeOH(2:1) extract of assemblage of two cyanobacteria, Oscillatoria sp. and Hormoscilla sp. |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Thiopalmyrone (CHEBI:67607) has role metabolite (CHEBI:25212) |
| Thiopalmyrone (CHEBI:67607) is a organosulfur heterocyclic compound (CHEBI:38106) |
| Synonym | Source |
|---|---|
| (2R)-2-(hydroxymethyl)-4-methoxy-2,3-dihydrothiopyran-6-one | ChEBI |
| Citations |
|---|