EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H8N2O |
| Net Charge | 0 |
| Average Mass | 232.242 |
| Monoisotopic Mass | 232.06366 |
| SMILES | O=C1c2ccccc2-c2nccc3ccnc1c23 |
| InChI | InChI=1S/C15H8N2O/c18-15-11-4-2-1-3-10(11)13-12-9(5-7-16-13)6-8-17-14(12)15/h1-8H |
| InChIKey | BWQKHOMAOVUASZ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ambavia gerrardii (ncbitaxon:224845) | root (BTO:0001188) | PubMed (21504145) | Isolated from the ethanolic extract of dried, ground roots. |
| Cananga odorata (ncbitaxon:13393) | bark (BTO:0001301) | PubMed (10843589) | Isolated from stem bark. |
| Duguetia hadrantha (ncbitaxon:294152) | - | PubMed (11374943) | |
| Anaxagorea dolichocarpa (ncbitaxon:287587) | - | PubMed (21860364) | |
| Polyalthia nemoralis (IPNI:74668-1) | bark (BTO:0001301) | DOI (10.1177/1934578X1701200706) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sampangine (CHEBI:67606) has role antifungal agent (CHEBI:35718) |
| sampangine (CHEBI:67606) has role plant metabolite (CHEBI:76924) |
| sampangine (CHEBI:67606) is a alkaloid (CHEBI:22315) |
| sampangine (CHEBI:67606) is a organic heterotetracyclic compound (CHEBI:38163) |
| IUPAC Name |
|---|
| 7H-naphtho[1,2,3-ij][2,7]naphthyridin-7-one |
| Synonyms | Source |
|---|---|
| 1,6-diaza-benzo[de]anthracen-7-one | ChEBI |
| sampangin | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0034291 | HMDB |
| FDB012630 | FooDB |
| C00046373 | KNApSAcK |
| 343168 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:116664-93-8 | ChemIDplus |
| Citations |
|---|