EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H8N2 |
| Net Charge | 0 |
| Average Mass | 204.232 |
| Monoisotopic Mass | 204.06875 |
| SMILES | c1ccc2c(c1)-c1nccc3ccnc-2c13 |
| InChI | InChI=1S/C14H8N2/c1-2-4-11-10(3-1)13-12-9(5-7-15-13)6-8-16-14(11)12/h1-8H |
| InChIKey | KIVUUVOREYMMFE-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ambavia gerrardii (ncbitaxon:224845) | root (BTO:0001188) | PubMed (21504145) | Ethanolic extract of dried, ground roots |
| Cananga odorata (ncbitaxon:13393) | - | PubMed (21504145) | |
| Eupomatia laurina (ncbitaxon:49863) | - | PubMed (21504145) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Eupolauridine (CHEBI:67605) has role metabolite (CHEBI:25212) |
| Eupolauridine (CHEBI:67605) is a naphthyridine derivative (CHEBI:73539) |
| Synonym | Source |
|---|---|
| Indeno(1,2,3-ij)(2,7)naphthyridine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0030182 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:58786-39-3 | ChemIDplus |
| Citations |
|---|