EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H8N2O |
| Net Charge | 0 |
| Average Mass | 220.231 |
| Monoisotopic Mass | 220.06366 |
| SMILES | [O-][n+]1ccc2ccnc3c2c1-c1ccccc1-3 |
| InChI | InChI=1S/C14H8N2O/c17-16-8-6-9-5-7-15-13-10-3-1-2-4-11(10)14(16)12(9)13/h1-8H |
| InChIKey | OEFOMVQWNBXRQW-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ambavia gerrardii (ncbitaxon:224845) | root (BTO:0001188) | PubMed (21504145) | Ethanolic extract of dried, ground roots |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Eupolauridine N-oxide (CHEBI:67604) has role metabolite (CHEBI:25212) |
| Eupolauridine N-oxide (CHEBI:67604) is a naphthyridine derivative (CHEBI:73539) |
| Synonym | Source |
|---|---|
| Indeno[1,2,3-ij][2,7]naphthyridine 1-oxide | ChEBI |
| Citations |
|---|