EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H50O2 |
| Net Charge | 0 |
| Average Mass | 442.728 |
| Monoisotopic Mass | 442.38108 |
| SMILES | [H][C@]12CC[C@@]3([H])[C@@](C)(CC[C@@]4([H])C(C)(C)[C@H](O)C[C@@H](O)[C@]34C)[C@]1(C)CC[C@@]1(C)CC[C@@H](C(=C)C)[C@@]12[H] |
| InChI | InChI=1S/C30H50O2/c1-18(2)19-11-13-27(5)15-16-28(6)20(25(19)27)9-10-22-29(28,7)14-12-21-26(3,4)23(31)17-24(32)30(21,22)8/h19-25,31-32H,1,9-17H2,2-8H3/t19-,20+,21-,22-,23+,24+,25+,27+,28+,29+,30-/m0/s1 |
| InChIKey | SWEUJTWPRYKNNX-DZEONHSJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Breynia fruticosa (ncbitaxon:296042) | root (BTO:0001188) | PubMed (21428418) | 90% Methanolic extract of air-dried, crushed roots. |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 20(29)-lupene-1β,3α-diol (CHEBI:67598) has parent hydride lupane (CHEBI:36485) |
| 20(29)-lupene-1β,3α-diol (CHEBI:67598) has role plant metabolite (CHEBI:76924) |
| 20(29)-lupene-1β,3α-diol (CHEBI:67598) is a diol (CHEBI:23824) |
| 20(29)-lupene-1β,3α-diol (CHEBI:67598) is a pentacyclic triterpenoid (CHEBI:25872) |
| IUPAC Name |
|---|
| lup-20(29)-ene-1β,3α-diol |
| Synonym | Source |
|---|---|
| glochidiol | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6575511 | Reaxys |
| Citations |
|---|