EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H46O |
| Net Charge | 0 |
| Average Mass | 422.697 |
| Monoisotopic Mass | 422.35487 |
| SMILES | [H][C@]12CC[C@]3([H])[C@@]4(C)C=CC(=O)C(C)(C)[C@]4([H])CC[C@@]3(C)[C@]1(C)CC[C@@]1(C)CC[C@@H](C(=C)C)[C@@]12[H] |
| InChI | InChI=1S/C30H46O/c1-19(2)20-11-14-27(5)17-18-29(7)21(25(20)27)9-10-23-28(6)15-13-24(31)26(3,4)22(28)12-16-30(23,29)8/h13,15,20-23,25H,1,9-12,14,16-18H2,2-8H3/t20-,21+,22-,23+,25+,27+,28-,29+,30+/m0/s1 |
| InChIKey | FWBYBHVDDGVPDF-BHMAJAPKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Breynia fruticosa (ncbitaxon:296042) | root (BTO:0001188) | PubMed (21428418) | 90% Methanolic extract of air-dried, crushed roots. |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glochidone (CHEBI:67596) has parent hydride lupane (CHEBI:36485) |
| glochidone (CHEBI:67596) has role plant metabolite (CHEBI:76924) |
| glochidone (CHEBI:67596) is a cyclic terpene ketone (CHEBI:36130) |
| glochidone (CHEBI:67596) is a pentacyclic triterpenoid (CHEBI:25872) |
| IUPAC Name |
|---|
| lupa-1,20(29)-dien-3-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2341167 | Reaxys |
| Citations |
|---|