EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H50O2 |
| Net Charge | 0 |
| Average Mass | 430.717 |
| Monoisotopic Mass | 430.38108 |
| SMILES | [H][C@]12CC[C@@]3(C)[C@@]([H])(CC[C@]3([H])[C@H](C)CC[C@@H](CC)C(C)C)[C@]1([H])[C@H](O)C=C1C[C@@H](O)CC[C@@]12C |
| InChI | InChI=1S/C29H50O2/c1-7-20(18(2)3)9-8-19(4)23-10-11-24-27-25(13-15-29(23,24)6)28(5)14-12-22(30)16-21(28)17-26(27)31/h17-20,22-27,30-31H,7-16H2,1-6H3/t19-,20-,22+,23-,24+,25+,26-,27+,28+,29-/m1/s1 |
| InChIKey | SXJVFYZNUGGHRG-GDDJFQTCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Breynia fruticosa (ncbitaxon:296042) | root (BTO:0001188) | PubMed (21428418) | 90% Methanolic extract of air-dried, crushed roots. |
| Melia toosendan (ncbitaxon:71608) | fruit (BTO:0000486) | PubMed (20961091) | 95% ethanolic extract of dried fruits |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| stigmast-5-ene-3β,7α-diol (CHEBI:67594) has functional parent sitosterol (CHEBI:27693) |
| stigmast-5-ene-3β,7α-diol (CHEBI:67594) has parent hydride stigmastane (CHEBI:26773) |
| stigmast-5-ene-3β,7α-diol (CHEBI:67594) has role metabolite (CHEBI:25212) |
| stigmast-5-ene-3β,7α-diol (CHEBI:67594) has role plant metabolite (CHEBI:76924) |
| stigmast-5-ene-3β,7α-diol (CHEBI:67594) is a 3β-hydroxy-Δ5-steroid (CHEBI:1722) |
| stigmast-5-ene-3β,7α-diol (CHEBI:67594) is a 7α-hydroxy steroid (CHEBI:36843) |
| IUPAC Name |
|---|
| (3β,7α)-stigmast-5-ene-3,7-diol |
| Synonym | Source |
|---|---|
| Hydroxysitosterol | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7001765 | Reaxys |
| CAS:34427-61-7 | ChemIDplus |
| Citations |
|---|