EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H46O4 |
| Net Charge | 0 |
| Average Mass | 470.694 |
| Monoisotopic Mass | 470.33961 |
| SMILES | [H][C@]12CC[C@@]3([H])[C@@](C)(CC[C@@]4([H])C(C)(C)[C@H](O)[C@@H](C=O)[C@]34C)[C@]1(C)CC[C@@]1(C(=O)O)CC[C@@H](C(=C)C)[C@@]12[H] |
| InChI | InChI=1S/C30H46O4/c1-17(2)18-10-13-30(25(33)34)15-14-27(5)19(23(18)30)8-9-22-28(27,6)12-11-21-26(3,4)24(32)20(16-31)29(21,22)7/h16,18-24,32H,1,8-15H2,2-7H3,(H,33,34)/t18-,19+,20+,21-,22-,23+,24+,27+,28+,29-,30-/m0/s1 |
| InChIKey | SLWJVQQNDGLXTK-IMBMMKFRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Breynia fruticosa (ncbitaxon:296042) | root (BTO:0001188) | PubMed (21428418) | 90% Methanolic extract of air-dried, crushed roots. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zizyberanalic acid (CHEBI:67591) has role plant metabolite (CHEBI:76924) |
| zizyberanalic acid (CHEBI:67591) is a 3α-hydroxy steroid (CHEBI:36835) |
| zizyberanalic acid (CHEBI:67591) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| zizyberanalic acid (CHEBI:67591) is a steroid acid (CHEBI:47891) |
| zizyberanalic acid (CHEBI:67591) is a steroid aldehyde (CHEBI:131565) |
| IUPAC Name |
|---|
| (1R,3aS,5aR,5bR,7aR,9R,10S,10aR,10bR,12aR,12bR)-10-formyl-9-hydroxy-5a,5b,8,8,10a-pentamethyl-1-(prop-1-en-2-yl)octadecahydrodicyclopenta[a,i]phenanthrene-3a(1H)-carboxylic acid |
| Synonym | Source |
|---|---|
| Colubrinic acid | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0036847 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6988830 | Reaxys |
| Citations |
|---|