EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H58O9 |
| Net Charge | 0 |
| Average Mass | 646.862 |
| Monoisotopic Mass | 646.40808 |
| SMILES | [H][C@@]1(O[C@@H]2O[C@@H](C)[C@H](O)[C@@H](O)[C@H]2O)[C@@H](C)[C@]2([H])CC=C3[C@]4([H])CC[C@]([H])([C@@H](CCC(=C)C(C)C)C(=O)O)[C@@]4(C)CC[C@]3([H])[C@@]2(C)C[C@H]1OC(C)=O |
| InChI | InChI=1S/C37H58O9/c1-18(2)19(3)9-10-24(34(42)43)27-14-13-26-23-11-12-25-20(4)33(46-35-32(41)31(40)30(39)21(5)44-35)29(45-22(6)38)17-37(25,8)28(23)15-16-36(26,27)7/h11,18,20-21,24-33,35,39-41H,3,9-10,12-17H2,1-2,4-8H3,(H,42,43)/t20-,21-,24+,25-,26-,27+,28-,29+,30-,31+,32+,33+,35-,36-,37-/m0/s1 |
| InChIKey | LOHRCIAMXCCSQS-RTWLVPPYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Breynia fruticosa (ncbitaxon:296042) | root (BTO:0001188) | PubMed (21428418) | 90% Methanolic extract of air-dried, crushed roots. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fruticoside E (CHEBI:67588) has functional parent α-L-rhamnopyranose (CHEBI:27907) |
| fruticoside E (CHEBI:67588) has role plant metabolite (CHEBI:76924) |
| fruticoside E (CHEBI:67588) is a acetate ester (CHEBI:47622) |
| fruticoside E (CHEBI:67588) is a deoxymannose derivative (CHEBI:63346) |
| fruticoside E (CHEBI:67588) is a monocarboxylic acid (CHEBI:25384) |
| fruticoside E (CHEBI:67588) is a steroid acid (CHEBI:47891) |
| fruticoside E (CHEBI:67588) is a steroid ester (CHEBI:47880) |
| fruticoside E (CHEBI:67588) is a steroid saponin (CHEBI:61655) |
| IUPAC Name |
|---|
| (2α,3β,4α,5α)-2-(acetyloxy)-3-[(6-deoxy-α-L-mannopyranosyl)oxy]-4-methylergosta-7,24(28)-dien-21-oic acid |
| Synonym | Source |
|---|---|
| 4α-methyl-2α-acetoxy-5α-ergost-7,24(28)-dien-21-oic acid-3β-O-α-L-rhamnopyranoside | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21553374 | Reaxys |
| Citations |
|---|