EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H46O4 |
| Net Charge | 0 |
| Average Mass | 458.683 |
| Monoisotopic Mass | 458.33961 |
| SMILES | [H][C@@]12CC[C@]([H])([C@@H](CCC(=C)C(C)C)C(=O)O)[C@@]1(C)CC[C@@]1([H])C2=CC[C@@]2([H])[C@H](C)[C@@H](O)[C@H](O)C[C@]12C |
| InChI | InChI=1S/C29H46O4/c1-16(2)17(3)7-8-20(27(32)33)23-12-11-22-19-9-10-21-18(4)26(31)25(30)15-29(21,6)24(19)13-14-28(22,23)5/h9,16,18,20-26,30-31H,3,7-8,10-15H2,1-2,4-6H3,(H,32,33)/t18-,20+,21-,22-,23+,24-,25+,26+,28-,29-/m0/s1 |
| InChIKey | AYCQAFSTPBCSLH-GDMQXADVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Breynia fruticosa (ncbitaxon:296042) | root (BTO:0001188) | PubMed (21428418) | 90% Methanolic extract of air-dried, crushed roots. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fruticoside B (CHEBI:67585) has role plant metabolite (CHEBI:76924) |
| fruticoside B (CHEBI:67585) is a 3β-hydroxy steroid (CHEBI:36836) |
| fruticoside B (CHEBI:67585) is a monocarboxylic acid (CHEBI:25384) |
| fruticoside B (CHEBI:67585) is a steroid acid (CHEBI:47891) |
| IUPAC Name |
|---|
| (2α,3β,4α,5α)-2,3-dihydroxy-4-methylergosta-7,24(28)-dien-21-oic acid |
| Synonym | Source |
|---|---|
| 4α-methyl-2α,3β-dihydroxy-5α-ergost-7,24(28)-dien-21-oic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21553369 | Reaxys |
| Citations |
|---|