EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H48O3 |
| Net Charge | 0 |
| Average Mass | 444.700 |
| Monoisotopic Mass | 444.36035 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](CO)CCC(=C)C(C)C)[C@@]1(C)CC[C@@]1([H])C2=CC[C@@]2([H])[C@H](C)[C@@H](O)[C@H](O)C[C@]12C |
| InChI | InChI=1S/C29H48O3/c1-17(2)18(3)7-8-20(16-30)23-11-12-24-21-9-10-22-19(4)27(32)26(31)15-29(22,6)25(21)13-14-28(23,24)5/h9,17,19-20,22-27,30-32H,3,7-8,10-16H2,1-2,4-6H3/t19-,20-,22-,23+,24-,25-,26+,27+,28+,29-/m0/s1 |
| InChIKey | OJCFPYLTKWNLCE-CBUQHMQYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Breynia fruticosa (ncbitaxon:296042) | root (BTO:0001188) | PubMed (21428418) | 90% Methanolic extract of air-dried, crushed roots. |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fruticoside A (CHEBI:67584) has role antineoplastic agent (CHEBI:35610) |
| fruticoside A (CHEBI:67584) has role plant metabolite (CHEBI:76924) |
| fruticoside A (CHEBI:67584) is a 21-hydroxy steroid (CHEBI:35344) |
| fruticoside A (CHEBI:67584) is a 3β-hydroxy steroid (CHEBI:36836) |
| fruticoside A (CHEBI:67584) is a triol (CHEBI:27136) |
| IUPAC Name |
|---|
| (2α,3β,4α,5α)-4-methylergosta-7,24(28)-diene-2,3,21-triol |
| Synonym | Source |
|---|---|
| 4α-methyl-2α,3β,21-trihydroxy-5α-ergost-7,24(28)-diene | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21553368 | Reaxys |
| Citations |
|---|