EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H28O3 |
| Net Charge | 0 |
| Average Mass | 340.463 |
| Monoisotopic Mass | 340.20384 |
| SMILES | CC(C)=CCCC1(C)C=Cc2cc(C(=O)O)cc(CC=C(C)C)c2O1 |
| InChI | InChI=1S/C22H28O3/c1-15(2)7-6-11-22(5)12-10-18-14-19(21(23)24)13-17(20(18)25-22)9-8-16(3)4/h7-8,10,12-14H,6,9,11H2,1-5H3,(H,23,24) |
| InChIKey | TXHBNVYFCZMCPB-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Piper gaudichaudianum (ncbitaxon:538273) | |||
| root (BTO:0001188) | PubMed (21506530) | Ethylacetate extract of powdered leaves,stems and roots of adult plant | |
| stem (BTO:0001300) | PubMed (21506530) | Ethylacetate extract of powdered leaves,stems and roots of adult plant | |
| leaf (BTO:0000713) | PubMed (21506530) | Ethylacetate extract of powdered leaves,stems and roots of adult plant |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gaudichaudianic acid, (-rac) (CHEBI:67582) has role metabolite (CHEBI:25212) |
| Gaudichaudianic acid, (-rac) (CHEBI:67582) is a 1-benzopyran (CHEBI:38443) |
| Synonym | Source |
|---|---|
| rac-2-Methyl-8-(3-methyl-2-buten-1-yl)-2-(4-methyl-3-penten-1-yl)-2H-chromene-6-carboxylic acid | ChEBI |
| Citations |
|---|