EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H14N2O3 |
| Net Charge | 0 |
| Average Mass | 246.266 |
| Monoisotopic Mass | 246.10044 |
| SMILES | CCC1(c2ccccc2)C(=O)NC(=O)N(C)C1=O |
| InChI | InChI=1S/C13H14N2O3/c1-3-13(9-7-5-4-6-8-9)10(16)14-12(18)15(2)11(13)17/h4-8H,3H2,1-2H3,(H,14,16,18) |
| InChIKey | ALARQZQTBTVLJV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. |
| Applications: | anticonvulsant A drug used to prevent seizures or reduce their severity. GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mephobarbital (CHEBI:6758) has role anticonvulsant (CHEBI:35623) |
| mephobarbital (CHEBI:6758) is a barbiturates (CHEBI:22693) |
| IUPAC Name |
|---|
| 5-ethyl-1-methyl-5-phenylpyrimidine-2,4,6(1H,3H,5H)-trione |
| INNs | Source |
|---|---|
| metilfenobarbital | DrugBank |
| methylphenobarbitalum | DrugBank |
| methylphenobarbital | KEGG DRUG |
| Synonyms | Source |
|---|---|
| Mephobarbital | KEGG COMPOUND |
| 1-methylphenobarbital | NIST Chemistry WebBook |
| 5-ethyl-1-methyl-5-phenyl-2,4,6(1H,3H,5H)-pyrimidinetrione | NIST Chemistry WebBook |
| 5-ethyl-1-methyl-5-phenylbarbituric acid | NIST Chemistry WebBook |
| N-methylphenobarbital | NIST Chemistry WebBook |
| Mebaral | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C07829 | KEGG COMPOUND |
| DB00849 | DrugBank |
| Methylphenobarbital | Wikipedia |
| D00700 | KEGG DRUG |
| HMDB0014987 | HMDB |
| 1696 | DrugCentral |
| Citations |
|---|