EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H48N10O10 |
| Net Charge | 0 |
| Average Mass | 672.741 |
| Monoisotopic Mass | 672.35549 |
| SMILES | [H][C@]12N/C(=N/[C@@H]3O[C@H](CO)[C@H](OC(N)=O)[C@@H](O)[C@H]3NC(=O)C[C@H](CCCNC(=O)C[C@@H](N)CCCN)NC(C)=O)N[C@]1([H])[C@H](O)CNC2=O |
| InChI | InChI=1S/C27H48N10O10/c1-12(39)33-14(5-3-7-31-17(41)8-13(29)4-2-6-28)9-18(42)34-21-22(43)23(47-26(30)45)16(11-38)46-25(21)37-27-35-19-15(40)10-32-24(44)20(19)36-27/h13-16,19-23,25,38,40,43H,2-11,28-29H2,1H3,(H2,30,45)(H,31,41)(H,32,44)(H,33,39)(H,34,42)(H2,35,36,37)/t13-,14-,15+,16+,19+,20-,21+,22-,23-,25+/m0/s1 |
| InChIKey | UESKGPZDXYFMJF-IVVRDDJBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces species I08A 1776 (ncbitaxon:945930) | - | PubMed (21510638) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nbeta-acetylstreptothricin E (CHEBI:67578) has role metabolite (CHEBI:25212) |
| Nbeta-acetylstreptothricin E (CHEBI:67578) is a organic molecular entity (CHEBI:50860) |
| Synonyms | Source |
|---|---|
| AN-201 I | ChEBI |
| beta-D-Gulopyranosylamine, 2-[[(3S)-3-(acetylamino)-6-[[(3S)-3,6-diamino-1-oxohexyl]amino]-1-oxohexyl]amino]-2-deoxy-N-[(3aS,7R,7aS)-octahydro-7-hydroxy-4-oxo-2H-imidazo[4,5-c]pyridin-2-ylidene]-, 4-carbamate | ChEBI |
| Citations |
|---|