EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H46N10O9 |
| Net Charge | 0 |
| Average Mass | 630.704 |
| Monoisotopic Mass | 630.34492 |
| SMILES | [H][C@]12N=C(N[C@@H]3O[C@H](CO)[C@H](OC(N)=O)[C@@H](O)[C@H]3NC(=O)C[C@@H](N)CCCNC(=O)C[C@@H](N)CCCN)N[C@]1([H])[C@H](O)CNC2=O |
| InChI | InChI=1S/C25H46N10O9/c26-5-1-3-11(27)7-15(38)30-6-2-4-12(28)8-16(39)32-19-20(40)21(44-24(29)42)14(10-36)43-23(19)35-25-33-17-13(37)9-31-22(41)18(17)34-25/h11-14,17-21,23,36-37,40H,1-10,26-28H2,(H2,29,42)(H,30,38)(H,31,41)(H,32,39)(H2,33,34,35)/t11-,12-,13+,14+,17+,18-,19+,20-,21-,23+/m0/s1 |
| InChIKey | SCHKAKNJXBPJHD-SNQQVPMJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces species I08A 1776 (ncbitaxon:945930) | - | PubMed (21510638) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| streptothricin E (CHEBI:67576) has role metabolite (CHEBI:25212) |
| streptothricin E (CHEBI:67576) is a amino sugar (CHEBI:28963) |
| Synonyms | Source |
|---|---|
| Yazumycin C | ChEBI |
| Racemomycin C | ChEBI |
| 4H-Imidazo(4,5-c)pyridin-4-one, 2-((2-(3-amino-6-(3,6-diaminohexanamido)hexanamido)-2-deoxy-beta-D-gulopyranosyl)amino)-3,3a,5,6,7,7a-hexahydro-7-hydroxy-, 6'-carbamate | ChEBI |
| Antibiotic S 15-1B | ChEBI |
| Streptolin A | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:3776-38-3 | ChemIDplus |
| Citations |
|---|