EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H46N10O9 |
| Net Charge | 0 |
| Average Mass | 630.704 |
| Monoisotopic Mass | 630.34492 |
| SMILES | [H][C@]12N/C(=N/[C@@H]3O[C@H](COC(N)=O)[C@H](O)[C@@H](O)[C@H]3NC(=O)C[C@@H](N)CCCNC(=O)C[C@@H](N)CCCN)N[C@]1([H])[C@H](O)CNC2=O |
| InChI | InChI=1S/C25H46N10O9/c26-5-1-3-11(27)7-15(37)30-6-2-4-12(28)8-16(38)32-19-21(40)20(39)14(10-43-24(29)42)44-23(19)35-25-33-17-13(36)9-31-22(41)18(17)34-25/h11-14,17-21,23,36,39-40H,1-10,26-28H2,(H2,29,42)(H,30,37)(H,31,41)(H,32,38)(H2,33,34,35)/t11-,12-,13+,14+,17+,18-,19+,20-,21-,23+/m0/s1 |
| InChIKey | TWWOHQBJOSKKBN-SNQQVPMJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces species I08A 1776 (ncbitaxon:945930) | - | PubMed (21510638) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (-)-(2S,3S,4R)-10-de-O-carbamoyl-12-O-carbamoylstreptothricin E (CHEBI:67575) has role metabolite (CHEBI:25212) |
| (-)-(2S,3S,4R)-10-de-O-carbamoyl-12-O-carbamoylstreptothricin E (CHEBI:67575) is a amino sugar (CHEBI:28963) |
| Synonym | Source |
|---|---|
| beta-D-Gulopyranosylamine, 2-[[(3S)-3-amino-6-[[(3S)-3,6-diamino-1-oxohexyl]amino]-1-oxohexyl]amino]-2-deoxy-N-[(3aS,7R,7aS)-octahydro-7-hydroxy-4-oxo-2H-imidazo[4,5-c]pyridin-2-ylidene]-, 6-carbamate | ChEBI |
| Citations |
|---|