EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H38N8O10 |
| Net Charge | 0 |
| Average Mass | 562.581 |
| Monoisotopic Mass | 562.27109 |
| SMILES | [H][C@]1(C(=O)O)N/C(=N/[C@@H]2O[C@H](COC(N)=O)[C@H](O)[C@@H](O)[C@H]2NC(=O)C[C@H](CCCN)NC(C)=O)N[C@]1([H])[C@H](O)CN |
| InChI | InChI=1S/C21H38N8O10/c1-8(30)25-9(3-2-4-22)5-12(32)26-15-17(34)16(33)11(7-38-20(24)37)39-18(15)29-21-27-13(10(31)6-23)14(28-21)19(35)36/h9-11,13-18,31,33-34H,2-7,22-23H2,1H3,(H2,24,37)(H,25,30)(H,26,32)(H,35,36)(H2,27,28,29)/t9-,10+,11+,13+,14-,15+,16-,17-,18+/m0/s1 |
| InChIKey | LDYDNDBXTDINHR-VSELPKQMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces species I08A 1776 (ncbitaxon:945930) | - | PubMed (21510638) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-(2S,3S,4R)-10-de-O-carbamoyl-12-O-carbamoyl-Nbeta-acetylstreptothricin F acid (CHEBI:67572) has role metabolite (CHEBI:25212) |
| (+)-(2S,3S,4R)-10-de-O-carbamoyl-12-O-carbamoyl-Nbeta-acetylstreptothricin F acid (CHEBI:67572) is a amino sugar (CHEBI:28963) |
| Synonym | Source |
|---|---|
| 2-{[(3S)-3-Acetamido-6-aminohexanoyl]amino}-N-{(2E,4S,5S)-5-[(1R)-2-amino-1-hydroxyethyl]-4-carboxy-4,5-dihydro-1H-imidazol-2-yl}-6-O-carbamoyl-2-deoxy-beta-D-gulopyranosylamine | ChEBI |
| Citations |
|---|