EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H42O5 |
| Net Charge | 0 |
| Average Mass | 470.650 |
| Monoisotopic Mass | 470.30322 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)[C@H]3CC[C@H](C)C(=O)O3)[C@@]1(C)C[C@@H](OC(C)=O)[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@@]21C |
| InChI | InChI=1S/C29H42O5/c1-16-6-11-24(34-27(16)32)17(2)22-9-10-23-21-8-7-19-14-20(31)12-13-28(19,4)26(21)25(33-18(3)30)15-29(22,23)5/h14,16-17,21-26H,6-13,15H2,1-5H3/t16-,17-,21-,22+,23-,24+,25+,26+,28-,29+/m0/s1 |
| InChIKey | INZKQBNBXNYQRQ-MOFMAXGTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Paraminabea acronocephala (WORMS:290662) | - | PubMed (21425785) | Ethanolic extract of minced frozen bodies |
| Roles Classification |
|---|
| Biological Roles: | coral metabolite Any animal metabolite produced during a metabolic reaction in corals (marine invertebrates). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| minabeolide 8 (CHEBI:67570) has role anti-inflammatory agent (CHEBI:67079) |
| minabeolide 8 (CHEBI:67570) has role coral metabolite (CHEBI:76498) |
| minabeolide 8 (CHEBI:67570) is a acetate ester (CHEBI:47622) |
| minabeolide 8 (CHEBI:67570) is a cholestanoid (CHEBI:50401) |
| minabeolide 8 (CHEBI:67570) is a enone (CHEBI:51689) |
| minabeolide 8 (CHEBI:67570) is a organic heterotetracyclic compound (CHEBI:38163) |
| minabeolide 8 (CHEBI:67570) is a withanolide (CHEBI:74716) |
| minabeolide 8 (CHEBI:67570) is a δ-lactone (CHEBI:18946) |
| IUPAC Name |
|---|
| (11α,22R,25S)-3,26-dioxo-22,26-epoxycholest-4-en-11-yl acetate |
| Synonyms | Source |
|---|---|
| 28-nor-3-oxo-11α-acetoxy-with-4-enolide | ChEBI |
| minabeolide-8 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21534308 | Reaxys |
| Citations |
|---|