EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H40O5 |
| Net Charge | 0 |
| Average Mass | 468.634 |
| Monoisotopic Mass | 468.28757 |
| SMILES | [H][C@@]12CCC3=CC(=O)C=C[C@]3(C)[C@@]1([H])CC[C@@]1(COC(C)=O)[C@@]2([H])CC[C@]1([H])[C@H](C)[C@H]1CC[C@H](C)C(=O)O1 |
| InChI | InChI=1S/C29H40O5/c1-17-5-10-26(34-27(17)32)18(2)23-8-9-25-22-7-6-20-15-21(31)11-13-28(20,4)24(22)12-14-29(23,25)16-33-19(3)30/h11,13,15,17-18,22-26H,5-10,12,14,16H2,1-4H3/t17-,18-,22+,23+,24-,25-,26+,28-,29-/m0/s1 |
| InChIKey | KMDRJFYWGCLAGL-NXAGNEQWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Paraminabea acronocephala (WORMS:290662) | - | PubMed (21425785) | Ethanolic extract of minced frozen bodies |
| Roles Classification |
|---|
| Biological Roles: | coral metabolite Any animal metabolite produced during a metabolic reaction in corals (marine invertebrates). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| minabeolide 5 (CHEBI:67569) has role anti-inflammatory agent (CHEBI:67079) |
| minabeolide 5 (CHEBI:67569) has role coral metabolite (CHEBI:76498) |
| minabeolide 5 (CHEBI:67569) is a acetate ester (CHEBI:47622) |
| minabeolide 5 (CHEBI:67569) is a cholestanoid (CHEBI:50401) |
| minabeolide 5 (CHEBI:67569) is a enone (CHEBI:51689) |
| minabeolide 5 (CHEBI:67569) is a organic heterotetracyclic compound (CHEBI:38163) |
| minabeolide 5 (CHEBI:67569) is a withanolide (CHEBI:74716) |
| minabeolide 5 (CHEBI:67569) is a δ-lactone (CHEBI:18946) |
| IUPAC Name |
|---|
| (22R,25S)-3,26-dioxo-22,26-epoxycholesta-1,4-dien-18-yl acetate |
| Synonyms | Source |
|---|---|
| 28-nor-3-oxo-18-acetoxy-witha-1,4-dienolide | ChEBI |
| minabeolide-5 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21534306 | Reaxys |
| Citations |
|---|