EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H38O3 |
| Net Charge | 0 |
| Average Mass | 410.598 |
| Monoisotopic Mass | 410.28210 |
| SMILES | [H][C@@]12CCC3=CC(=O)C=C[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@H](C)[C@H]1CC[C@H](C)C(=O)O1 |
| InChI | InChI=1S/C27H38O3/c1-16-5-10-24(30-25(16)29)17(2)21-8-9-22-20-7-6-18-15-19(28)11-13-26(18,3)23(20)12-14-27(21,22)4/h11,13,15-17,20-24H,5-10,12,14H2,1-4H3/t16-,17-,20-,21+,22-,23-,24+,26-,27+/m0/s1 |
| InChIKey | OIROZVSBVQAEPT-HDSKOFFVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Paraminabea acronocephala (WORMS:290662) | - | PubMed (21425785) | Ethanolic extract of minced frozen bodies |
| Roles Classification |
|---|
| Biological Roles: | coral metabolite Any animal metabolite produced during a metabolic reaction in corals (marine invertebrates). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| minabeolide 4 (CHEBI:67568) has role anti-inflammatory agent (CHEBI:67079) |
| minabeolide 4 (CHEBI:67568) has role coral metabolite (CHEBI:76498) |
| minabeolide 4 (CHEBI:67568) is a 3-oxo-Δ1,Δ4-steroid (CHEBI:77166) |
| minabeolide 4 (CHEBI:67568) is a cholestanoid (CHEBI:50401) |
| minabeolide 4 (CHEBI:67568) is a organic heterotetracyclic compound (CHEBI:38163) |
| minabeolide 4 (CHEBI:67568) is a withanolide (CHEBI:74716) |
| minabeolide 4 (CHEBI:67568) is a δ-lactone (CHEBI:18946) |
| IUPAC Name |
|---|
| (22R,25S)-22,26-epoxycholesta-1,4-diene-3,26-dione |
| Synonyms | Source |
|---|---|
| 28-nor-3-oxo-witha-1,4-dienolide | ChEBI |
| minabeolide-4 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21534299 | Reaxys |
| Citations |
|---|