EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H38O3 |
| Net Charge | 0 |
| Average Mass | 422.609 |
| Monoisotopic Mass | 422.28210 |
| SMILES | [H][C@@]12CCC3=CC(=O)C=C[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@H](C)[C@H]1CC(C)=C(C)C(=O)O1 |
| InChI | InChI=1S/C28H38O3/c1-16-14-25(31-26(30)17(16)2)18(3)22-8-9-23-21-7-6-19-15-20(29)10-12-27(19,4)24(21)11-13-28(22,23)5/h10,12,15,18,21-25H,6-9,11,13-14H2,1-5H3/t18-,21-,22+,23-,24-,25+,27-,28+/m0/s1 |
| InChIKey | XNASBJNLSIWJAM-CCSWOSDBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Paraminabea acronocephala (WORMS:290662) | - | PubMed (21425785) | Ethanolic extract of minced frozen bodies |
| Roles Classification |
|---|
| Biological Roles: | coral metabolite Any animal metabolite produced during a metabolic reaction in corals (marine invertebrates). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| minabeolide 1 (CHEBI:67566) has role anti-inflammatory agent (CHEBI:67079) |
| minabeolide 1 (CHEBI:67566) has role antineoplastic agent (CHEBI:35610) |
| minabeolide 1 (CHEBI:67566) has role coral metabolite (CHEBI:76498) |
| minabeolide 1 (CHEBI:67566) is a 3-oxo-Δ1,Δ4-steroid (CHEBI:77166) |
| minabeolide 1 (CHEBI:67566) is a ergostanoid (CHEBI:50403) |
| minabeolide 1 (CHEBI:67566) is a organic heterotetracyclic compound (CHEBI:38163) |
| minabeolide 1 (CHEBI:67566) is a withanolide (CHEBI:74716) |
| minabeolide 1 (CHEBI:67566) is a δ-lactone (CHEBI:18946) |
| IUPAC Name |
|---|
| (22R)-22,26-epoxyergosta-1,4,24-triene-3,26-dione |
| Synonyms | Source |
|---|---|
| 3-oxo-witha-1,4,24-trienolide | ChEBI |
| minabeolide-1 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21534300 | Reaxys |
| Citations |
|---|