EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H40O4 |
| Net Charge | 0 |
| Average Mass | 440.624 |
| Monoisotopic Mass | 440.29266 |
| SMILES | [H][C@@]1([C@@H](O)[C@@H](C)[C@@]2([H])CC[C@@]3([H])[C@]4([H])CCC5=CC(=O)C=C[C@]5(C)[C@@]4([H])CC[C@@]32C)OC(=O)[C@H](C)[C@@H]1C |
| InChI | InChI=1S/C28H40O4/c1-15-16(2)26(31)32-25(15)24(30)17(3)21-8-9-22-20-7-6-18-14-19(29)10-12-27(18,4)23(20)11-13-28(21,22)5/h10,12,14-17,20-25,30H,6-9,11,13H2,1-5H3/t15-,16+,17-,20-,21+,22-,23-,24-,25+,27-,28+/m0/s1 |
| InChIKey | UISXVQNCBCKQHL-PPGQKZPJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Paraminabea acronocephala (WORMS:290662) | - | PubMed (21425785) | Ethanolic extract of minced frozen bodies |
| Roles Classification |
|---|
| Biological Roles: | coral metabolite Any animal metabolite produced during a metabolic reaction in corals (marine invertebrates). EC 1.14.13.39 (nitric oxide synthase) inhibitor An EC 1.14.13.* (oxidoreductase acting on paired donors, incorporating 1 atom of oxygen, with NADH or NADPH as one donor) inhibitor that interferes with the action of nitric oxide synthase (EC 1.14.13.39). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| paraminabeolide D (CHEBI:67563) has role coral metabolite (CHEBI:76498) |
| paraminabeolide D (CHEBI:67563) has role EC 1.14.13.39 (nitric oxide synthase) inhibitor (CHEBI:61908) |
| paraminabeolide D (CHEBI:67563) is a 3-oxo-Δ1,Δ4-steroid (CHEBI:77166) |
| paraminabeolide D (CHEBI:67563) is a ergostanoid (CHEBI:50403) |
| paraminabeolide D (CHEBI:67563) is a secondary alcohol (CHEBI:35681) |
| paraminabeolide D (CHEBI:67563) is a withanolide (CHEBI:74716) |
| paraminabeolide D (CHEBI:67563) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (22S,23R,24S,25R)-22-hydroxy-23,26-epoxyergosta-1,4-diene-3,26-dione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21534303 | Reaxys |
| Citations |
|---|