EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H42O6 |
| Net Charge | 0 |
| Average Mass | 498.660 |
| Monoisotopic Mass | 498.29814 |
| SMILES | [H][C@@]1([C@@H](O)[C@@H](C)[C@@]2([H])CC[C@@]3([H])[C@]4([H])CCC5=CC(=O)C=C[C@]5(C)[C@@]4([H])CC[C@@]32COC(C)=O)OC(=O)[C@H](C)[C@H]1C |
| InChI | InChI=1S/C30H42O6/c1-16-17(2)28(34)36-27(16)26(33)18(3)23-8-9-25-22-7-6-20-14-21(32)10-12-29(20,5)24(22)11-13-30(23,25)15-35-19(4)31/h10,12,14,16-18,22-27,33H,6-9,11,13,15H2,1-5H3/t16-,17-,18+,22-,23-,24+,25+,26+,27-,29+,30+/m1/s1 |
| InChIKey | CFLDASSGYNALJR-DYJDMTRPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Paraminabea acronocephala (WORMS:290662) | - | PubMed (21425785) | Ethanolic extract of minced frozen bodies |
| Roles Classification |
|---|
| Biological Roles: | coral metabolite Any animal metabolite produced during a metabolic reaction in corals (marine invertebrates). EC 1.14.13.39 (nitric oxide synthase) inhibitor An EC 1.14.13.* (oxidoreductase acting on paired donors, incorporating 1 atom of oxygen, with NADH or NADPH as one donor) inhibitor that interferes with the action of nitric oxide synthase (EC 1.14.13.39). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| paraminabeolide C (CHEBI:67562) has role coral metabolite (CHEBI:76498) |
| paraminabeolide C (CHEBI:67562) has role EC 1.14.13.39 (nitric oxide synthase) inhibitor (CHEBI:61908) |
| paraminabeolide C (CHEBI:67562) is a 3-oxo-Δ1,Δ4-steroid (CHEBI:77166) |
| paraminabeolide C (CHEBI:67562) is a acetate ester (CHEBI:47622) |
| paraminabeolide C (CHEBI:67562) is a ergostanoid (CHEBI:50403) |
| paraminabeolide C (CHEBI:67562) is a secondary alcohol (CHEBI:35681) |
| paraminabeolide C (CHEBI:67562) is a steroid ester (CHEBI:47880) |
| paraminabeolide C (CHEBI:67562) is a withanolide (CHEBI:74716) |
| paraminabeolide C (CHEBI:67562) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (22S,23R,25R)-22-hydroxy-3,26-dioxo-23,26-epoxyergosta-1,4-dien-18-yl acetate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21534309 | Reaxys |
| Citations |
|---|