EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H42O5 |
| Net Charge | 0 |
| Average Mass | 482.661 |
| Monoisotopic Mass | 482.30322 |
| SMILES | [H][C@@]12CCC3=CC(=O)C=C[C@]3(C)[C@@]1([H])CC[C@@]1(COC(C)=O)[C@@]2([H])CC[C@]1([H])[C@H](C)[C@@]1([H])C[C@H](C)[C@H](C)C(=O)O1 |
| InChI | InChI=1S/C30H42O5/c1-17-14-27(35-28(33)18(17)2)19(3)24-8-9-26-23-7-6-21-15-22(32)10-12-29(21,5)25(23)11-13-30(24,26)16-34-20(4)31/h10,12,15,17-19,23-27H,6-9,11,13-14,16H2,1-5H3/t17-,18-,19-,23+,24+,25-,26-,27+,29-,30-/m0/s1 |
| InChIKey | CJVKACGPAQCXAA-RXQWXACOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Paraminabea acronocephala (WORMS:290662) | - | PubMed (21425785) | Ethanolic extract of minced frozen bodies |
| Roles Classification |
|---|
| Biological Roles: | coral metabolite Any animal metabolite produced during a metabolic reaction in corals (marine invertebrates). EC 1.14.13.39 (nitric oxide synthase) inhibitor An EC 1.14.13.* (oxidoreductase acting on paired donors, incorporating 1 atom of oxygen, with NADH or NADPH as one donor) inhibitor that interferes with the action of nitric oxide synthase (EC 1.14.13.39). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| paraminabeolide B (CHEBI:67561) has role coral metabolite (CHEBI:76498) |
| paraminabeolide B (CHEBI:67561) has role EC 1.14.13.39 (nitric oxide synthase) inhibitor (CHEBI:61908) |
| paraminabeolide B (CHEBI:67561) is a 3-oxo-Δ1,Δ4-steroid (CHEBI:77166) |
| paraminabeolide B (CHEBI:67561) is a acetate ester (CHEBI:47622) |
| paraminabeolide B (CHEBI:67561) is a ergostanoid (CHEBI:50403) |
| paraminabeolide B (CHEBI:67561) is a steroid ester (CHEBI:47880) |
| paraminabeolide B (CHEBI:67561) is a withanolide (CHEBI:74716) |
| paraminabeolide B (CHEBI:67561) is a δ-lactone (CHEBI:18946) |
| IUPAC Name |
|---|
| (22R,25S)-3,26-dioxo-22,26-epoxyergosta-1,4-dien-18-yl acetate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21534305 | Reaxys |
| Citations |
|---|