EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22O7 |
| Net Charge | 0 |
| Average Mass | 362.378 |
| Monoisotopic Mass | 362.13655 |
| SMILES | COc1cc(O)c2c(c1)/C=C/C[C@H](O)[C@H](O)C(=O)/C=C\C[C@H](C)OC2=O |
| InChI | InChI=1S/C19H22O7/c1-11-5-3-7-14(20)18(23)15(21)8-4-6-12-9-13(25-2)10-16(22)17(12)19(24)26-11/h3-4,6-7,9-11,15,18,21-23H,5,8H2,1-2H3/b6-4+,7-3-/t11-,15-,18+/m0/s1 |
| InChIKey | NEQZWEXWOFPKOT-BYRRXHGESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fungi | - | PubMed (21513293) | MeOH-CHCl3(1:1) extract of Mycosynthetix fungus isolated from leaflitter Strain: MSX 63935 |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. NF-kappaB inhibitor An inhibitor of NF-κB (nuclear factor κ-light-chain-enhancer of activated B cells), a protein complex involved in the transcription of DNA. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5Z-7-oxozeaenol (CHEBI:67559) has role antibacterial agent (CHEBI:33282) |
| 5Z-7-oxozeaenol (CHEBI:67559) has role antineoplastic agent (CHEBI:35610) |
| 5Z-7-oxozeaenol (CHEBI:67559) has role metabolite (CHEBI:25212) |
| 5Z-7-oxozeaenol (CHEBI:67559) has role NF-κB inhibitor (CHEBI:73240) |
| 5Z-7-oxozeaenol (CHEBI:67559) is a aromatic ether (CHEBI:35618) |
| 5Z-7-oxozeaenol (CHEBI:67559) is a macrolide (CHEBI:25106) |
| 5Z-7-oxozeaenol (CHEBI:67559) is a phenols (CHEBI:33853) |
| 5Z-7-oxozeaenol (CHEBI:67559) is a secondary alcohol (CHEBI:35681) |
| 5Z-7-oxozeaenol (CHEBI:67559) is a secondary α-hydroxy ketone (CHEBI:2468) |
| IUPAC Name |
|---|
| (3S,5Z,8S,9S,11E)-8,9,16-trihydroxy-14-methoxy-3-methyl-3,4,9,10-tetrahydro-1H-2-benzoxacyclotetradecine-1,7(8H)-dione |
| Synonym | Source |
|---|---|
| LL-Z1640-2 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8800797 | Reaxys |
| Citations |
|---|