EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H24O7 |
| Net Charge | 0 |
| Average Mass | 364.394 |
| Monoisotopic Mass | 364.15220 |
| SMILES | COc1cc(O)c2c(c1)/C=C/C[C@H](O)[C@H](O)[C@@H](O)/C=C/C[C@H](C)OC2=O |
| InChI | InChI=1S/C19H24O7/c1-11-5-3-7-14(20)18(23)15(21)8-4-6-12-9-13(25-2)10-16(22)17(12)19(24)26-11/h3-4,6-7,9-11,14-15,18,20-23H,5,8H2,1-2H3/b6-4+,7-3+/t11-,14-,15-,18+/m0/s1 |
| InChIKey | BPOLRDGTYHVUAY-YMFWJEOZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cochliobolus lunatus (ncbitaxon:5503) | - | PubMed (21348465) | EtOAc extract, fungus isolated from gorgonian coral Dichotella gemmacea |
| Fungi | - | PubMed (21513293) | MeOH-CHCl3(1:1) extract of Mycosynthetix fungus isolated from leaflitter Strain: MSX 63935 |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. NF-kappaB inhibitor An inhibitor of NF-κB (nuclear factor κ-light-chain-enhancer of activated B cells), a protein complex involved in the transcription of DNA. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zeaenol (CHEBI:67556) has role antibacterial agent (CHEBI:33282) |
| zeaenol (CHEBI:67556) has role metabolite (CHEBI:25212) |
| zeaenol (CHEBI:67556) has role NF-κB inhibitor (CHEBI:73240) |
| zeaenol (CHEBI:67556) is a aromatic ether (CHEBI:35618) |
| zeaenol (CHEBI:67556) is a macrolide (CHEBI:25106) |
| zeaenol (CHEBI:67556) is a phenols (CHEBI:33853) |
| zeaenol (CHEBI:67556) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (3S,5E,7S,8S,9S,11E)-7,8,9,16-tetrahydroxy-14-methoxy-3-methyl-3,4,7,8,9,10-hexahydro-1H-2-benzoxacyclotetradecin-1-one |
| Synonym | Source |
|---|---|
| (2E,5S,6S,7S,8E,11S)-5,6,7,15-tetrahydroxy-17-methoxy-11-methyl-12-oxabicyclo[12.4.0]octadeca-1(14),2,8,15,17-pentaen-13-one | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5484017 | Reaxys |
| Citations |
|---|