EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H24O7 |
| Net Charge | 0 |
| Average Mass | 364.394 |
| Monoisotopic Mass | 364.15220 |
| SMILES | COc1cc(O)c2c(c1)/C=C/C[C@H](O)[C@H](O)[C@@H](O)/C=C/C[C@H](C)OC2=O |
| InChI | InChI=1S/C19H24O7/c1-11-5-3-7-14(20)18(23)15(21)8-4-6-12-9-13(25-2)10-16(22)17(12)19(24)26-11/h3-4,6-7,9-11,14-15,18,20-23H,5,8H2,1-2H3/b6-4+,7-3+/t11-,14-,15-,18+/m0/s1 |
| InChIKey | BPOLRDGTYHVUAY-YMFWJEOZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cochliobolus lunatus (ncbitaxon:5503) | - | PubMed (21348465) | EtOAc extract, fungus isolated from gorgonian coral Dichotella gemmacea |
| Fungi | - | PubMed (21513293) | MeOH-CHCl3(1:1) extract of Mycosynthetix fungus isolated from leaflitter Strain: MSX 63935 |
| Roles Classification |
|---|
| Biological Roles: | NF-kappaB inhibitor An inhibitor of NF-κB (nuclear factor κ-light-chain-enhancer of activated B cells), a protein complex involved in the transcription of DNA. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zeaenol (CHEBI:67556) has role antibacterial agent (CHEBI:33282) |
| zeaenol (CHEBI:67556) has role metabolite (CHEBI:25212) |
| zeaenol (CHEBI:67556) has role NF-κB inhibitor (CHEBI:73240) |
| zeaenol (CHEBI:67556) is a aromatic ether (CHEBI:35618) |
| zeaenol (CHEBI:67556) is a macrolide (CHEBI:25106) |
| zeaenol (CHEBI:67556) is a phenols (CHEBI:33853) |
| zeaenol (CHEBI:67556) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (3S,5E,7S,8S,9S,11E)-7,8,9,16-tetrahydroxy-14-methoxy-3-methyl-3,4,7,8,9,10-hexahydro-1H-2-benzoxacyclotetradecin-1-one |
| Synonym | Source |
|---|---|
| (2E,5S,6S,7S,8E,11S)-5,6,7,15-tetrahydroxy-17-methoxy-11-methyl-12-oxabicyclo[12.4.0]octadeca-1(14),2,8,15,17-pentaen-13-one | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5484017 | Reaxys |
| Citations |
|---|