EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H20O7 |
| Net Charge | 0 |
| Average Mass | 348.351 |
| Monoisotopic Mass | 348.12090 |
| SMILES | C[C@H]1C/C=C\C(=O)[C@@H](O)[C@@H](O)C/C=C/c2cc(O)cc(O)c2C(=O)O1 |
| InChI | InChI=1S/C18H20O7/c1-10-4-2-6-13(20)17(23)14(21)7-3-5-11-8-12(19)9-15(22)16(11)18(24)25-10/h2-3,5-6,8-10,14,17,19,21-23H,4,7H2,1H3/b5-3+,6-2-/t10-,14-,17+/m0/s1 |
| InChIKey | PVEKMPNUMRVXDU-DWCLIQAISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fungi | - | PubMed (21513293) | MeOH-CHCl3(1:1) extract of Mycosynthetix fungus isolated from leaflitter Strain: MSX 63935 |
| Roles Classification |
|---|
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. NF-kappaB inhibitor An inhibitor of NF-κB (nuclear factor κ-light-chain-enhancer of activated B cells), a protein complex involved in the transcription of DNA. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 15-O-desmethyl-(5Z)-7-oxozeaenol (CHEBI:67555) has role fungal metabolite (CHEBI:76946) |
| 15-O-desmethyl-(5Z)-7-oxozeaenol (CHEBI:67555) has role NF-κB inhibitor (CHEBI:73240) |
| 15-O-desmethyl-(5Z)-7-oxozeaenol (CHEBI:67555) is a macrolide (CHEBI:25106) |
| 15-O-desmethyl-(5Z)-7-oxozeaenol (CHEBI:67555) is a resorcinols (CHEBI:33572) |
| 15-O-desmethyl-(5Z)-7-oxozeaenol (CHEBI:67555) is a secondary alcohol (CHEBI:35681) |
| 15-O-desmethyl-(5Z)-7-oxozeaenol (CHEBI:67555) is a secondary α-hydroxy ketone (CHEBI:2468) |
| IUPAC Name |
|---|
| (3S,5Z,8S,9S,11E)-8,9,14,16-tetrahydroxy-3-methyl-3,4,9,10-tetrahydro-1H-2-benzoxacyclotetradecine-1,7(8H)-dione |
| Citations |
|---|