EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H10O5 |
| Net Charge | 0 |
| Average Mass | 258.229 |
| Monoisotopic Mass | 258.05282 |
| SMILES | COc1ccc(O)c2c(=O)c3cc(O)ccc3oc12 |
| InChI | InChI=1S/C14H10O5/c1-18-11-5-3-9(16)12-13(17)8-6-7(15)2-4-10(8)19-14(11)12/h2-6,15-16H,1H3 |
| InChIKey | YDZGWMWSKOGVLG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cratoxylum cochinchinense (ncbitaxon:271749) | stem (BTO:0001300) | PubMed (21428375) | Methanolic extract of dried and ground stems |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,7-dihydroxy-4-methoxyxanthone (CHEBI:67553) has role metabolite (CHEBI:25212) |
| 1,7-dihydroxy-4-methoxyxanthone (CHEBI:67553) has role plant metabolite (CHEBI:76924) |
| 1,7-dihydroxy-4-methoxyxanthone (CHEBI:67553) is a aromatic ether (CHEBI:35618) |
| 1,7-dihydroxy-4-methoxyxanthone (CHEBI:67553) is a phenols (CHEBI:33853) |
| 1,7-dihydroxy-4-methoxyxanthone (CHEBI:67553) is a xanthones (CHEBI:51149) |
| IUPAC Name |
|---|
| 1,7-dihydroxy-4-methoxy-9H-xanthen-9-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5347180 | Reaxys |
| Citations |
|---|