EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H24O6 |
| Net Charge | 0 |
| Average Mass | 396.439 |
| Monoisotopic Mass | 396.15729 |
| SMILES | CC(C)=CCc1c(O)cc2oc3cc(O)c(O)c(CC=C(C)C)c3c(=O)c2c1O |
| InChI | InChI=1S/C23H24O6/c1-11(2)5-7-13-15(24)9-18-20(22(13)27)23(28)19-14(8-6-12(3)4)21(26)16(25)10-17(19)29-18/h5-6,9-10,24-27H,7-8H2,1-4H3 |
| InChIKey | VEZXFTKZUMARDU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cratoxylum cochinchinense (ncbitaxon:271749) | stem (BTO:0001300) | PubMed (21428375) | Methanolic extract of dried and ground stems |
| Roles Classification |
|---|
| Biological Roles: | protein kinase inhibitor An EC 2.7.* (P-containing group transferase) inhibitor that interferes with the action of protein kinases. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| γ-mangostin (CHEBI:67548) has role antineoplastic agent (CHEBI:35610) |
| γ-mangostin (CHEBI:67548) has role plant metabolite (CHEBI:76924) |
| γ-mangostin (CHEBI:67548) has role protein kinase inhibitor (CHEBI:37699) |
| γ-mangostin (CHEBI:67548) is a phenols (CHEBI:33853) |
| γ-mangostin (CHEBI:67548) is a xanthones (CHEBI:51149) |
| IUPAC Name |
|---|
| 1,3,6,7-tetrahydroxy-2,8-bis(3-methylbut-2-en-1-yl)-9H-xanthen-9-one |
| Manual Xrefs | Databases |
|---|---|
| CN101658517 | Patent |
| HMDB0035795 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5161429 | Reaxys |
| CAS:31271-07-5 | ChemIDplus |
| Citations |
|---|